C9H12F4O4 — CID 152734803
[1-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl] prop-2-enoate (PubChem CID 152734803) has the molecular formula C9H12F4O4 and a molecular weight of 260.18 g/mol. Its IUPAC name is [1-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl] prop-2-enoate.
| Compound Name | [1-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl] prop-2-enoate |
|---|---|
| PubChem CID | 152734803 |
| Molecular Formula | C9H12F4O4 |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | [1-hydroxy-3-(2,2,3,3-tetrafluoropropoxy)propyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(O)CCOCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H12F4O4/c1-2-6(14)17-7(15)3-4-16-5-9(12,13)8(10)11/h2,7-8,15H,1,3-5H2 |
| InChIKey | ZYJKNXKEIDSEBW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|