C11H14F4O4 — CID 174893406
methyl prop-2-enoate;2,2,3,3-tetrafluoropropyl 2-methylprop-2-enoate (PubChem CID 174893406) has the molecular formula C11H14F4O4 and a molecular weight of 286.22 g/mol. Its IUPAC name is methyl prop-2-enoate;2,2,3,3-tetrafluoropropyl 2-methylprop-2-enoate.
| Compound Name | methyl prop-2-enoate;2,2,3,3-tetrafluoropropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174893406 |
| Molecular Formula | C11H14F4O4 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | methyl prop-2-enoate;2,2,3,3-tetrafluoropropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(F)(F)C(F)F.C=CC(=O)OC |
| InChI | InChI=1S/C7H8F4O2.C4H6O2/c1-4(2)5(12)13-3-7(10,11)6(8)9;1-3-4(5)6-2/h6H,1,3H2,2H3;3H,1H2,2H3 |
| InChIKey | USIOGTVVSVUFDG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|