C13H23NO6 — CID 173410542
azane;methyl 2-methylprop-2-enoate;methyl prop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 173410542) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is azane;methyl 2-methylprop-2-enoate;methyl prop-2-enoate;2-methylprop-2-enoic acid.
| Compound Name | azane;methyl 2-methylprop-2-enoate;methyl prop-2-enoate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 173410542 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | azane;methyl 2-methylprop-2-enoate;methyl prop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OC.C=CC(=O)OC.N |
| InChI | InChI=1S/C5H8O2.2C4H6O2.H3N/c1-4(2)5(6)7-3;1-3-4(5)6-2;1-3(2)4(5)6;/h1H2,2-3H3;3H,1H2,2H3;1H2,2H3,(H,5,6);1H3 |
| InChIKey | JXYTZGCGIVISBH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|