About methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;trihydrochloride
methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;trihydrochloride (PubChem CID 172746567) has the molecular formula C9H17Cl3O4
and a molecular weight of 295.59 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;trihydrochloride.
Molecular Properties
| Compound Name | methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;trihydrochloride |
| PubChem CID | 172746567 |
| Molecular Formula | C9H17Cl3O4 |
| Molecular Weight | 295.59 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;trihydrochloride |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OC.Cl.Cl.Cl |
| InChI | InChI=1S/C5H8O2.C4H6O2.3ClH/c1-4(2)5(6)7-3;1-3(2)4(5)6;;;/h1H2,2-3H3;1H2,2H3,(H,5,6);3*1H |
| InChIKey | XKIIIPMVYICDOM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.59 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;trihydrochloride?
The IUPAC name of methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;trihydrochloride (CID 172746567) is methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;trihydrochloride.
What is the SMILES notation for methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;trihydrochloride?
The canonical SMILES for methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;trihydrochloride is C=C(C)C(=O)O.C=C(C)C(=O)OC.Cl.Cl.Cl.
What is the InChIKey of methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;trihydrochloride?
The InChIKey is XKIIIPMVYICDOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C4H6O2.3ClH/c1-4(2)5(6)7-3;1-3(2)4(5)6;;;/h1H2,2-3H3;1H2,2H3,(H,5,6);3*1H.
What are the key properties of methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;trihydrochloride?
methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;trihydrochloride has a molecular weight of 295.59 g/mol, XLogP of 2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid;trihydrochloride is sourced from PubChem (CID 172746567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).