About methyl 2-methylprop-2-enoate;polane
methyl 2-methylprop-2-enoate;polane (PubChem CID 173074189) has the molecular formula C5H10O2Po
and a molecular weight of 311.13 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;polane.
Molecular Properties
| Compound Name | methyl 2-methylprop-2-enoate;polane |
| PubChem CID | 173074189 |
| Molecular Formula | C5H10O2Po |
| Molecular Weight | 311.13 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | methyl 2-methylprop-2-enoate;polane |
| SMILES | C=C(C)C(=O)OC.[PoH2] |
| InChI | InChI=1S/C5H8O2.Po.2H/c1-4(2)5(6)7-3;;;/h1H2,2-3H3;;; |
| InChIKey | DHJQQOBBOPIABV-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.13 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methylprop-2-enoate;polane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylprop-2-enoate;polane?
The IUPAC name of methyl 2-methylprop-2-enoate;polane (CID 173074189) is methyl 2-methylprop-2-enoate;polane.
What is the SMILES notation for methyl 2-methylprop-2-enoate;polane?
The canonical SMILES for methyl 2-methylprop-2-enoate;polane is C=C(C)C(=O)OC.[PoH2].
What is the InChIKey of methyl 2-methylprop-2-enoate;polane?
The InChIKey is DHJQQOBBOPIABV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.Po.2H/c1-4(2)5(6)7-3;;;/h1H2,2-3H3;;;.
What are the key properties of methyl 2-methylprop-2-enoate;polane?
methyl 2-methylprop-2-enoate;polane has a molecular weight of 311.13 g/mol, XLogP of -0.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylprop-2-enoate;polane is sourced from PubChem (CID 173074189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).