About deuterium monohydride;methyl 2-methylprop-2-enoate
deuterium monohydride;methyl 2-methylprop-2-enoate (PubChem CID 161063033) has the molecular formula C5H10O2
and a molecular weight of 103.14 g/mol. Its IUPAC name is deuterium monohydride;methyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | deuterium monohydride;methyl 2-methylprop-2-enoate |
| PubChem CID | 161063033 |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 103.14 g/mol |
| Exact Mass | 103.07 |
| IUPAC Name | deuterium monohydride;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.[H][2H] |
| InChI | InChI=1S/C5H8O2.H2/c1-4(2)5(6)7-3;/h1H2,2-3H3;1H/i;1+1 |
| InChIKey | UDQKZZFJXDWNPP-IEOVAKBOSA-N |
| XLogP | 0.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.14 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze deuterium monohydride;methyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterium monohydride;methyl 2-methylprop-2-enoate?
The IUPAC name of deuterium monohydride;methyl 2-methylprop-2-enoate (CID 161063033) is deuterium monohydride;methyl 2-methylprop-2-enoate.
What is the SMILES notation for deuterium monohydride;methyl 2-methylprop-2-enoate?
The canonical SMILES for deuterium monohydride;methyl 2-methylprop-2-enoate is C=C(C)C(=O)OC.[H][2H].
What is the InChIKey of deuterium monohydride;methyl 2-methylprop-2-enoate?
The InChIKey is UDQKZZFJXDWNPP-IEOVAKBOSA-N. The full InChI is InChI=1S/C5H8O2.H2/c1-4(2)5(6)7-3;/h1H2,2-3H3;1H/i;1+1.
What are the key properties of deuterium monohydride;methyl 2-methylprop-2-enoate?
deuterium monohydride;methyl 2-methylprop-2-enoate has a molecular weight of 103.14 g/mol, XLogP of 0.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for deuterium monohydride;methyl 2-methylprop-2-enoate is sourced from PubChem (CID 161063033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).