About methane;bis(methyl 2-methylprop-2-enoate)
methane;bis(methyl 2-methylprop-2-enoate) (PubChem CID 159008219) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is methane;bis(methyl 2-methylprop-2-enoate).
Molecular Properties
| Compound Name | methane;bis(methyl 2-methylprop-2-enoate) |
| PubChem CID | 159008219 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | methane;bis(methyl 2-methylprop-2-enoate) |
| SMILES | C.C=C(C)C(=O)OC.C=C(C)C(=O)OC |
| InChI | InChI=1S/2C5H8O2.CH4/c2*1-4(2)5(6)7-3;/h2*1H2,2-3H3;1H4 |
| InChIKey | JSEMTHFLOOQIGL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methane;bis(methyl 2-methylprop-2-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;bis(methyl 2-methylprop-2-enoate)?
The IUPAC name of methane;bis(methyl 2-methylprop-2-enoate) (CID 159008219) is methane;bis(methyl 2-methylprop-2-enoate).
What is the SMILES notation for methane;bis(methyl 2-methylprop-2-enoate)?
The canonical SMILES for methane;bis(methyl 2-methylprop-2-enoate) is C.C=C(C)C(=O)OC.C=C(C)C(=O)OC.
What is the InChIKey of methane;bis(methyl 2-methylprop-2-enoate)?
The InChIKey is JSEMTHFLOOQIGL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H8O2.CH4/c2*1-4(2)5(6)7-3;/h2*1H2,2-3H3;1H4.
What are the key properties of methane;bis(methyl 2-methylprop-2-enoate)?
methane;bis(methyl 2-methylprop-2-enoate) has a molecular weight of 216.28 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;bis(methyl 2-methylprop-2-enoate) is sourced from PubChem (CID 159008219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).