C14H24O8 — CID 175208053
ethane-1,2-diol;methyl prop-2-enoate;bis(2-methylprop-2-enoic acid) (PubChem CID 175208053) has the molecular formula C14H24O8 and a molecular weight of 320.34 g/mol. Its IUPAC name is ethane-1,2-diol;methyl prop-2-enoate;bis(2-methylprop-2-enoic acid).
| Compound Name | ethane-1,2-diol;methyl prop-2-enoate;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 175208053 |
| Molecular Formula | C14H24O8 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | ethane-1,2-diol;methyl prop-2-enoate;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.C=CC(=O)OC.OCCO |
| InChI | InChI=1S/3C4H6O2.C2H6O2/c1-3-4(5)6-2;2*1-3(2)4(5)6;3-1-2-4/h3H,1H2,2H3;2*1H2,2H3,(H,5,6);3-4H,1-2H2 |
| InChIKey | CAGUKYPVWRKKCV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|