C28H58O6 — CID 173395438
bis(ethane-1,2-diol);ethene;2-methylprop-2-enoic acid (PubChem CID 173395438) has the molecular formula C28H58O6 and a molecular weight of 490.77 g/mol. Its IUPAC name is bis(ethane-1,2-diol);ethene;2-methylprop-2-enoic acid.
| Compound Name | bis(ethane-1,2-diol);ethene;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 173395438 |
| Molecular Formula | C28H58O6 |
| Molecular Weight | 490.77 g/mol |
| Exact Mass | 490.42 |
| IUPAC Name | bis(ethane-1,2-diol);ethene;2-methylprop-2-enoic acid |
| SMILES | C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C(C)C(=O)O.OCCO.OCCO |
| InChI | InChI=1S/C4H6O2.2C2H6O2.10C2H4/c1-3(2)4(5)6;2*3-1-2-4;10*1-2/h1H2,2H3,(H,5,6);2*3-4H,1-2H2;10*1-2H2 |
| InChIKey | KHOVCFNDLDBJPJ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.77 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|