About 2-bromoethanol;2-methylprop-2-enoic acid
2-bromoethanol;2-methylprop-2-enoic acid (PubChem CID 163915230) has the molecular formula C6H11BrO3
and a molecular weight of 211.05 g/mol. Its IUPAC name is 2-bromoethanol;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | 2-bromoethanol;2-methylprop-2-enoic acid |
| PubChem CID | 163915230 |
| Molecular Formula | C6H11BrO3 |
| Molecular Weight | 211.05 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | 2-bromoethanol;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.OCCBr |
| InChI | InChI=1S/C4H6O2.C2H5BrO/c1-3(2)4(5)6;3-1-2-4/h1H2,2H3,(H,5,6);4H,1-2H2 |
| InChIKey | QVQROLNRYXWTQI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.05 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoethanol;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoethanol;2-methylprop-2-enoic acid?
The IUPAC name of 2-bromoethanol;2-methylprop-2-enoic acid (CID 163915230) is 2-bromoethanol;2-methylprop-2-enoic acid.
What is the SMILES notation for 2-bromoethanol;2-methylprop-2-enoic acid?
The canonical SMILES for 2-bromoethanol;2-methylprop-2-enoic acid is C=C(C)C(=O)O.OCCBr.
What is the InChIKey of 2-bromoethanol;2-methylprop-2-enoic acid?
The InChIKey is QVQROLNRYXWTQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C2H5BrO/c1-3(2)4(5)6;3-1-2-4/h1H2,2H3,(H,5,6);4H,1-2H2.
What are the key properties of 2-bromoethanol;2-methylprop-2-enoic acid?
2-bromoethanol;2-methylprop-2-enoic acid has a molecular weight of 211.05 g/mol, XLogP of 1.02, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoethanol;2-methylprop-2-enoic acid is sourced from PubChem (CID 163915230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).