About CID 131883821
CID 131883821 (PubChem CID 131883821) has the molecular formula C8H12MgO4
and a molecular weight of 196.48 g/mol.
Molecular Properties
| Compound Name | CID 131883821 |
| PubChem CID | 131883821 |
| Molecular Formula | C8H12MgO4 |
| Molecular Weight | 196.48 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.[Mg] |
| InChI | InChI=1S/2C4H6O2.Mg/c2*1-3(2)4(5)6;/h2*1H2,2H3,(H,5,6); |
| InChIKey | SBKGSLWWYZRZPV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.48 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 131883821 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131883821?
The IUPAC name of CID 131883821 (CID 131883821) is not available.
What is the SMILES notation for CID 131883821?
The canonical SMILES for CID 131883821 is C=C(C)C(=O)O.C=C(C)C(=O)O.[Mg].
What is the InChIKey of CID 131883821?
The InChIKey is SBKGSLWWYZRZPV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H6O2.Mg/c2*1-3(2)4(5)6;/h2*1H2,2H3,(H,5,6);.
What are the key properties of CID 131883821?
CID 131883821 has a molecular weight of 196.48 g/mol, XLogP of 0.91, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131883821 is sourced from PubChem (CID 131883821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).