About dilithium;hydride;2-methylprop-2-enoic acid
dilithium;hydride;2-methylprop-2-enoic acid (PubChem CID 174560536) has the molecular formula C4H8Li2O2
and a molecular weight of 101.99 g/mol. Its IUPAC name is dilithium;hydride;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | dilithium;hydride;2-methylprop-2-enoic acid |
| PubChem CID | 174560536 |
| Molecular Formula | C4H8Li2O2 |
| Molecular Weight | 101.99 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | dilithium;hydride;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.[H-].[H-].[Li+].[Li+] |
| InChI | InChI=1S/C4H6O2.2Li.2H/c1-3(2)4(5)6;;;;/h1H2,2H3,(H,5,6);;;;/q;2*+1;2*-1 |
| InChIKey | GGTZSQYLSBSPHT-UHFFFAOYSA-N |
| XLogP | -5.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.99 |
| LogP ≤ 5 | -5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dilithium;hydride;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;hydride;2-methylprop-2-enoic acid?
The IUPAC name of dilithium;hydride;2-methylprop-2-enoic acid (CID 174560536) is dilithium;hydride;2-methylprop-2-enoic acid.
What is the SMILES notation for dilithium;hydride;2-methylprop-2-enoic acid?
The canonical SMILES for dilithium;hydride;2-methylprop-2-enoic acid is C=C(C)C(=O)O.[H-].[H-].[Li+].[Li+].
What is the InChIKey of dilithium;hydride;2-methylprop-2-enoic acid?
The InChIKey is GGTZSQYLSBSPHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.2Li.2H/c1-3(2)4(5)6;;;;/h1H2,2H3,(H,5,6);;;;/q;2*+1;2*-1.
What are the key properties of dilithium;hydride;2-methylprop-2-enoic acid?
dilithium;hydride;2-methylprop-2-enoic acid has a molecular weight of 101.99 g/mol, XLogP of -5.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;hydride;2-methylprop-2-enoic acid is sourced from PubChem (CID 174560536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).