About methanol;2-methylprop-2-enoic acid;propan-2-one
methanol;2-methylprop-2-enoic acid;propan-2-one (PubChem CID 174711674) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is methanol;2-methylprop-2-enoic acid;propan-2-one.
Molecular Properties
| Compound Name | methanol;2-methylprop-2-enoic acid;propan-2-one |
| PubChem CID | 174711674 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | methanol;2-methylprop-2-enoic acid;propan-2-one |
| SMILES | C=C(C)C(=O)O.CC(C)=O.CO |
| InChI | InChI=1S/C4H6O2.C3H6O.CH4O/c1-3(2)4(5)6;1-3(2)4;1-2/h1H2,2H3,(H,5,6);1-2H3;2H,1H3 |
| InChIKey | WLKPZGABVRBDNF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methanol;2-methylprop-2-enoic acid;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-methylprop-2-enoic acid;propan-2-one?
The IUPAC name of methanol;2-methylprop-2-enoic acid;propan-2-one (CID 174711674) is methanol;2-methylprop-2-enoic acid;propan-2-one.
What is the SMILES notation for methanol;2-methylprop-2-enoic acid;propan-2-one?
The canonical SMILES for methanol;2-methylprop-2-enoic acid;propan-2-one is C=C(C)C(=O)O.CC(C)=O.CO.
What is the InChIKey of methanol;2-methylprop-2-enoic acid;propan-2-one?
The InChIKey is WLKPZGABVRBDNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C3H6O.CH4O/c1-3(2)4(5)6;1-3(2)4;1-2/h1H2,2H3,(H,5,6);1-2H3;2H,1H3.
What are the key properties of methanol;2-methylprop-2-enoic acid;propan-2-one?
methanol;2-methylprop-2-enoic acid;propan-2-one has a molecular weight of 176.21 g/mol, XLogP of 0.85, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-methylprop-2-enoic acid;propan-2-one is sourced from PubChem (CID 174711674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).