C11H22O8 — CID 173402530
bis(ethane-1,2-diol);2-methylprop-2-enoic acid;prop-2-enoic acid (PubChem CID 173402530) has the molecular formula C11H22O8 and a molecular weight of 282.29 g/mol. Its IUPAC name is bis(ethane-1,2-diol);2-methylprop-2-enoic acid;prop-2-enoic acid.
| Compound Name | bis(ethane-1,2-diol);2-methylprop-2-enoic acid;prop-2-enoic acid |
|---|---|
| PubChem CID | 173402530 |
| Molecular Formula | C11H22O8 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | bis(ethane-1,2-diol);2-methylprop-2-enoic acid;prop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=CC(=O)O.OCCO.OCCO |
| InChI | InChI=1S/C4H6O2.C3H4O2.2C2H6O2/c1-3(2)4(5)6;1-2-3(4)5;2*3-1-2-4/h1H2,2H3,(H,5,6);2H,1H2,(H,4,5);2*3-4H,1-2H2 |
| InChIKey | MIXRLHHDFLBRJI-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|