C7H16O4Si2 — CID 173358641
2-methylprop-2-enoic acid;prop-2-enoic acid;silylsilane (PubChem CID 173358641) has the molecular formula C7H16O4Si2 and a molecular weight of 220.37 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;prop-2-enoic acid;silylsilane.
| Compound Name | 2-methylprop-2-enoic acid;prop-2-enoic acid;silylsilane |
|---|---|
| PubChem CID | 173358641 |
| Molecular Formula | C7H16O4Si2 |
| Molecular Weight | 220.37 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-methylprop-2-enoic acid;prop-2-enoic acid;silylsilane |
| SMILES | C=C(C)C(=O)O.C=CC(=O)O.[SiH3][SiH3] |
| InChI | InChI=1S/C4H6O2.C3H4O2.H6Si2/c1-3(2)4(5)6;1-2-3(4)5;1-2/h1H2,2H3,(H,5,6);2H,1H2,(H,4,5);1-2H3 |
| InChIKey | OLYLEJGRWNGDQA-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.37 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|