C11H18O5 — CID 174765174
2-methylprop-2-enoic acid;oxolane;prop-2-enoic acid (PubChem CID 174765174) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;oxolane;prop-2-enoic acid.
| Compound Name | 2-methylprop-2-enoic acid;oxolane;prop-2-enoic acid |
|---|---|
| PubChem CID | 174765174 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-methylprop-2-enoic acid;oxolane;prop-2-enoic acid |
| SMILES | C1CCOC1.C=C(C)C(=O)O.C=CC(=O)O |
| InChI | InChI=1S/C4H6O2.C4H8O.C3H4O2/c1-3(2)4(5)6;1-2-4-5-3-1;1-2-3(4)5/h1H2,2H3,(H,5,6);1-4H2;2H,1H2,(H,4,5) |
| InChIKey | GZUUXVMUUSXAQT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|