cyclohexane;2-methylprop-2-enoic acid

C10H18O2 — CID 66795649

IUPACcyclohexane;2-methylprop-2-enoic acid
SMILESC1CCCCC1.C=C(C)C(=O)O
InChIInChI=1S/C6H12.C4H6O2/c1-2-4-6-5-3-1;1-3(2)4(5)6/h1-6H2;1H2,2H3,(H,5,6)
InChIKeyPTWJGGCOPUFTFL-UHFFFAOYSA-N
MW170.25 g/mol
LogP2.99
Rot. Bonds1

About cyclohexane;2-methylprop-2-enoic acid

cyclohexane;2-methylprop-2-enoic acid (PubChem CID 66795649) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is cyclohexane;2-methylprop-2-enoic acid.

Molecular Properties

Compound Namecyclohexane;2-methylprop-2-enoic acid
PubChem CID66795649
Molecular FormulaC10H18O2
Molecular Weight170.25 g/mol
Exact Mass170.13
IUPAC Namecyclohexane;2-methylprop-2-enoic acid
SMILESC1CCCCC1.C=C(C)C(=O)O
InChIInChI=1S/C6H12.C4H6O2/c1-2-4-6-5-3-1;1-3(2)4(5)6/h1-6H2;1H2,2H3,(H,5,6)
InChIKeyPTWJGGCOPUFTFL-UHFFFAOYSA-N
XLogP2.99
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.25
LogP ≤ 52.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze cyclohexane;2-methylprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclohexane;2-methylprop-2-enoic acid?
The IUPAC name of cyclohexane;2-methylprop-2-enoic acid (CID 66795649) is cyclohexane;2-methylprop-2-enoic acid.
What is the SMILES notation for cyclohexane;2-methylprop-2-enoic acid?
The canonical SMILES for cyclohexane;2-methylprop-2-enoic acid is C1CCCCC1.C=C(C)C(=O)O.
What is the InChIKey of cyclohexane;2-methylprop-2-enoic acid?
The InChIKey is PTWJGGCOPUFTFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12.C4H6O2/c1-2-4-6-5-3-1;1-3(2)4(5)6/h1-6H2;1H2,2H3,(H,5,6).
What are the key properties of cyclohexane;2-methylprop-2-enoic acid?
cyclohexane;2-methylprop-2-enoic acid has a molecular weight of 170.25 g/mol, XLogP of 2.99, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;2-methylprop-2-enoic acid is sourced from PubChem (CID 66795649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).