C13H22O6 — CID 66888079
cyclohexane-1,4-diol;2-methylprop-2-enoic acid;prop-2-enoic acid (PubChem CID 66888079) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is cyclohexane-1,4-diol;2-methylprop-2-enoic acid;prop-2-enoic acid.
| Compound Name | cyclohexane-1,4-diol;2-methylprop-2-enoic acid;prop-2-enoic acid |
|---|---|
| PubChem CID | 66888079 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | cyclohexane-1,4-diol;2-methylprop-2-enoic acid;prop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=CC(=O)O.OC1CCC(O)CC1 |
| InChI | InChI=1S/C6H12O2.C4H6O2.C3H4O2/c7-5-1-2-6(8)4-3-5;1-3(2)4(5)6;1-2-3(4)5/h5-8H,1-4H2;1H2,2H3,(H,5,6);2H,1H2,(H,4,5) |
| InChIKey | WSKXSPDNRNLJEF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|