About ethenamine;2-methylprop-2-enoic acid
ethenamine;2-methylprop-2-enoic acid (PubChem CID 18702482) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is ethenamine;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | ethenamine;2-methylprop-2-enoic acid |
| PubChem CID | 18702482 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | ethenamine;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=CN |
| InChI | InChI=1S/C4H6O2.C2H5N/c1-3(2)4(5)6;1-2-3/h1H2,2H3,(H,5,6);2H,1,3H2 |
| InChIKey | QTAYDLXTZHAZSC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethenamine;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenamine;2-methylprop-2-enoic acid?
The IUPAC name of ethenamine;2-methylprop-2-enoic acid (CID 18702482) is ethenamine;2-methylprop-2-enoic acid.
What is the SMILES notation for ethenamine;2-methylprop-2-enoic acid?
The canonical SMILES for ethenamine;2-methylprop-2-enoic acid is C=C(C)C(=O)O.C=CN.
What is the InChIKey of ethenamine;2-methylprop-2-enoic acid?
The InChIKey is QTAYDLXTZHAZSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C2H5N/c1-3(2)4(5)6;1-2-3/h1H2,2H3,(H,5,6);2H,1,3H2.
What are the key properties of ethenamine;2-methylprop-2-enoic acid?
ethenamine;2-methylprop-2-enoic acid has a molecular weight of 129.16 g/mol, XLogP of 0.74, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenamine;2-methylprop-2-enoic acid is sourced from PubChem (CID 18702482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).