C9H15NO4 — CID 158189106
N-(hydroxymethyl)-2-methylprop-2-enamide;methyl prop-2-enoate (PubChem CID 158189106) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is N-(hydroxymethyl)-2-methylprop-2-enamide;methyl prop-2-enoate.
| Compound Name | N-(hydroxymethyl)-2-methylprop-2-enamide;methyl prop-2-enoate |
|---|---|
| PubChem CID | 158189106 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | N-(hydroxymethyl)-2-methylprop-2-enamide;methyl prop-2-enoate |
| SMILES | C=C(C)C(=O)NCO.C=CC(=O)OC |
| InChI | InChI=1S/C5H9NO2.C4H6O2/c1-4(2)5(8)6-3-7;1-3-4(5)6-2/h7H,1,3H2,2H3,(H,6,8);3H,1H2,2H3 |
| InChIKey | FZNFHOVVWSGDPA-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|