About 2-(2-hydroxyethoxy)ethanol;bis(methyl prop-2-enoate)
2-(2-hydroxyethoxy)ethanol;bis(methyl prop-2-enoate) (PubChem CID 160785980) has the molecular formula C12H22O7
and a molecular weight of 278.30 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;bis(methyl prop-2-enoate).
Molecular Properties
| Compound Name | 2-(2-hydroxyethoxy)ethanol;bis(methyl prop-2-enoate) |
| PubChem CID | 160785980 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;bis(methyl prop-2-enoate) |
| SMILES | C=CC(=O)OC.C=CC(=O)OC.OCCOCCO |
| InChI | InChI=1S/C4H10O3.2C4H6O2/c5-1-3-7-4-2-6;2*1-3-4(5)6-2/h5-6H,1-4H2;2*3H,1H2,2H3 |
| InChIKey | SBFBWIPQZLTKJA-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethoxy)ethanol;bis(methyl prop-2-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethoxy)ethanol;bis(methyl prop-2-enoate)?
The IUPAC name of 2-(2-hydroxyethoxy)ethanol;bis(methyl prop-2-enoate) (CID 160785980) is 2-(2-hydroxyethoxy)ethanol;bis(methyl prop-2-enoate).
What is the SMILES notation for 2-(2-hydroxyethoxy)ethanol;bis(methyl prop-2-enoate)?
The canonical SMILES for 2-(2-hydroxyethoxy)ethanol;bis(methyl prop-2-enoate) is C=CC(=O)OC.C=CC(=O)OC.OCCOCCO.
What is the InChIKey of 2-(2-hydroxyethoxy)ethanol;bis(methyl prop-2-enoate)?
The InChIKey is SBFBWIPQZLTKJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3.2C4H6O2/c5-1-3-7-4-2-6;2*1-3-4(5)6-2/h5-6H,1-4H2;2*3H,1H2,2H3.
What are the key properties of 2-(2-hydroxyethoxy)ethanol;bis(methyl prop-2-enoate)?
2-(2-hydroxyethoxy)ethanol;bis(methyl prop-2-enoate) has a molecular weight of 278.30 g/mol, XLogP of -0.32, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethoxy)ethanol;bis(methyl prop-2-enoate) is sourced from PubChem (CID 160785980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).