About 1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;methyl prop-2-enoate
1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;methyl prop-2-enoate (PubChem CID 158731688) has the molecular formula C14H28O7
and a molecular weight of 308.37 g/mol. Its IUPAC name is 1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;methyl prop-2-enoate.
Molecular Properties
| Compound Name | 1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;methyl prop-2-enoate |
| PubChem CID | 158731688 |
| Molecular Formula | C14H28O7 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;methyl prop-2-enoate |
| SMILES | C=CC(=O)OC.CCCCOC(O)COCCOCCO |
| InChI | InChI=1S/C10H22O5.C4H6O2/c1-2-3-5-15-10(12)9-14-8-7-13-6-4-11;1-3-4(5)6-2/h10-12H,2-9H2,1H3;3H,1H2,2H3 |
| InChIKey | ILEDUNJAAWZLTH-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;methyl prop-2-enoate?
The IUPAC name of 1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;methyl prop-2-enoate (CID 158731688) is 1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;methyl prop-2-enoate.
What is the SMILES notation for 1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;methyl prop-2-enoate?
The canonical SMILES for 1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;methyl prop-2-enoate is C=CC(=O)OC.CCCCOC(O)COCCOCCO.
What is the InChIKey of 1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;methyl prop-2-enoate?
The InChIKey is ILEDUNJAAWZLTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O5.C4H6O2/c1-2-3-5-15-10(12)9-14-8-7-13-6-4-11;1-3-4(5)6-2/h10-12H,2-9H2,1H3;3H,1H2,2H3.
What are the key properties of 1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;methyl prop-2-enoate?
1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;methyl prop-2-enoate has a molecular weight of 308.37 g/mol, XLogP of 0.49, 12 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxy-2-[2-(2-hydroxyethoxy)ethoxy]ethanol;methyl prop-2-enoate is sourced from PubChem (CID 158731688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).