C20H40O12 — CID 87255416
2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-1-methoxyethanol;prop-2-enoic acid (PubChem CID 87255416) has the molecular formula C20H40O12 and a molecular weight of 472.53 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-1-methoxyethanol;prop-2-enoic acid.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-1-methoxyethanol;prop-2-enoic acid |
|---|---|
| PubChem CID | 87255416 |
| Molecular Formula | C20H40O12 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-1-methoxyethanol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.COC(O)COCCOCCOCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C17H36O10.C3H4O2/c1-20-17(19)16-27-15-14-26-13-12-25-11-10-24-9-8-23-7-6-22-5-4-21-3-2-18;1-2-3(4)5/h17-19H,2-16H2,1H3;2H,1H2,(H,4,5) |
| InChIKey | SIIHPBVFDNFNLE-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 151.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|