C29H50O14 — CID 67882500
2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-1-phenoxyethanol;prop-2-enoic acid (PubChem CID 67882500) has the molecular formula C29H50O14 and a molecular weight of 622.71 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-1-phenoxyethanol;prop-2-enoic acid.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-1-phenoxyethanol;prop-2-enoic acid |
|---|---|
| PubChem CID | 67882500 |
| Molecular Formula | C29H50O14 |
| Molecular Weight | 622.71 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-1-phenoxyethanol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.OCCOCCOCCOCCOCCOCCOCCOCCOCCOCC(O)Oc1ccccc1 |
| InChI | InChI=1S/C26H46O12.C3H4O2/c27-6-7-29-8-9-30-10-11-31-12-13-32-14-15-33-16-17-34-18-19-35-20-21-36-22-23-37-24-26(28)38-25-4-2-1-3-5-25;1-2-3(4)5/h1-5,26-28H,6-24H2;2H,1H2,(H,4,5) |
| InChIKey | KCEJMIRLQWTSMJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 170.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.71 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|