C26H34O9 — CID 159557307
2-(2-hydroxyethoxy)-1-phenoxyethanol;2-methylprop-2-enoic acid;2-phenoxyethyl 2-methylprop-2-enoate (PubChem CID 159557307) has the molecular formula C26H34O9 and a molecular weight of 490.55 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)-1-phenoxyethanol;2-methylprop-2-enoic acid;2-phenoxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-(2-hydroxyethoxy)-1-phenoxyethanol;2-methylprop-2-enoic acid;2-phenoxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159557307 |
| Molecular Formula | C26H34O9 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 2-(2-hydroxyethoxy)-1-phenoxyethanol;2-methylprop-2-enoic acid;2-phenoxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OCCOc1ccccc1.OCCOCC(O)Oc1ccccc1 |
| InChI | InChI=1S/C12H14O3.C10H14O4.C4H6O2/c1-10(2)12(13)15-9-8-14-11-6-4-3-5-7-11;11-6-7-13-8-10(12)14-9-4-2-1-3-5-9;1-3(2)4(5)6/h3-7H,1,8-9H2,2H3;1-5,10-12H,6-8H2;1H2,2H3,(H,5,6) |
| InChIKey | MGDSAUATTMTQSD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|