C21H24O8 — CID 69167558
1-O-[2-(2-methylprop-2-enoyloxy)ethyl] 4-O-(2-phenoxyethyl) 2-acetyl-3-methylidenebutanedioate (PubChem CID 69167558) has the molecular formula C21H24O8 and a molecular weight of 404.42 g/mol. Its IUPAC name is 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] 4-O-(2-phenoxyethyl) 2-acetyl-3-methylidenebutanedioate.
| Compound Name | 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] 4-O-(2-phenoxyethyl) 2-acetyl-3-methylidenebutanedioate |
|---|---|
| PubChem CID | 69167558 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] 4-O-(2-phenoxyethyl) 2-acetyl-3-methylidenebutanedioate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(C(=C)C(=O)OCCOc1ccccc1)C(C)=O |
| InChI | InChI=1S/C21H24O8/c1-14(2)19(23)27-12-13-29-21(25)18(16(4)22)15(3)20(24)28-11-10-26-17-8-6-5-7-9-17/h5-9,18H,1,3,10-13H2,2,4H3 |
| InChIKey | ZHZBXGWCDWVAEZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|