About 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;toluene
2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;toluene (PubChem CID 163489883) has the molecular formula C17H22O4
and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;toluene.
Molecular Properties
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;toluene |
| PubChem CID | 163489883 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;toluene |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(=C)C.Cc1ccccc1 |
| InChI | InChI=1S/C10H14O4.C7H8/c1-7(2)9(11)13-5-6-14-10(12)8(3)4;1-7-5-3-2-4-6-7/h1,3,5-6H2,2,4H3;2-6H,1H3 |
| InChIKey | CLRPYVPVOLJFNM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;toluene?
The IUPAC name of 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;toluene (CID 163489883) is 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;toluene.
What is the SMILES notation for 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;toluene?
The canonical SMILES for 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;toluene is C=C(C)C(=O)OCCOC(=O)C(=C)C.Cc1ccccc1.
What is the InChIKey of 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;toluene?
The InChIKey is CLRPYVPVOLJFNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4.C7H8/c1-7(2)9(11)13-5-6-14-10(12)8(3)4;1-7-5-3-2-4-6-7/h1,3,5-6H2,2,4H3;2-6H,1H3.
What are the key properties of 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;toluene?
2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;toluene has a molecular weight of 290.36 g/mol, XLogP of 3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;toluene is sourced from PubChem (CID 163489883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).