About bis(2-methylprop-1-ene);toluene
bis(2-methylprop-1-ene);toluene (PubChem CID 158339604) has the molecular formula C15H24
and a molecular weight of 204.36 g/mol. Its IUPAC name is bis(2-methylprop-1-ene);toluene.
Molecular Properties
| Compound Name | bis(2-methylprop-1-ene);toluene |
| PubChem CID | 158339604 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | bis(2-methylprop-1-ene);toluene |
| SMILES | C=C(C)C.C=C(C)C.Cc1ccccc1 |
| InChI | InChI=1S/C7H8.2C4H8/c1-7-5-3-2-4-6-7;2*1-4(2)3/h2-6H,1H3;2*1H2,2-3H3 |
| InChIKey | GQZODLFADNKOBH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylprop-1-ene);toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylprop-1-ene);toluene?
The IUPAC name of bis(2-methylprop-1-ene);toluene (CID 158339604) is bis(2-methylprop-1-ene);toluene.
What is the SMILES notation for bis(2-methylprop-1-ene);toluene?
The canonical SMILES for bis(2-methylprop-1-ene);toluene is C=C(C)C.C=C(C)C.Cc1ccccc1.
What is the InChIKey of bis(2-methylprop-1-ene);toluene?
The InChIKey is GQZODLFADNKOBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8.2C4H8/c1-7-5-3-2-4-6-7;2*1-4(2)3/h2-6H,1H3;2*1H2,2-3H3.
What are the key properties of bis(2-methylprop-1-ene);toluene?
bis(2-methylprop-1-ene);toluene has a molecular weight of 204.36 g/mol, XLogP of 5.16, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylprop-1-ene);toluene is sourced from PubChem (CID 158339604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).