About ethane;methane;phenoxymethyl 2-methylprop-2-enoate
ethane;methane;phenoxymethyl 2-methylprop-2-enoate (PubChem CID 161278326) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is ethane;methane;phenoxymethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | ethane;methane;phenoxymethyl 2-methylprop-2-enoate |
| PubChem CID | 161278326 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | ethane;methane;phenoxymethyl 2-methylprop-2-enoate |
| SMILES | C.C.C=C(C)C(=O)OCOc1ccccc1.CC |
| InChI | InChI=1S/C11H12O3.C2H6.2CH4/c1-9(2)11(12)14-8-13-10-6-4-3-5-7-10;1-2;;/h3-7H,1,8H2,2H3;1-2H3;2*1H4 |
| InChIKey | VESWIHLLGGTHRT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;phenoxymethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;phenoxymethyl 2-methylprop-2-enoate?
The IUPAC name of ethane;methane;phenoxymethyl 2-methylprop-2-enoate (CID 161278326) is ethane;methane;phenoxymethyl 2-methylprop-2-enoate.
What is the SMILES notation for ethane;methane;phenoxymethyl 2-methylprop-2-enoate?
The canonical SMILES for ethane;methane;phenoxymethyl 2-methylprop-2-enoate is C.C.C=C(C)C(=O)OCOc1ccccc1.CC.
What is the InChIKey of ethane;methane;phenoxymethyl 2-methylprop-2-enoate?
The InChIKey is VESWIHLLGGTHRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3.C2H6.2CH4/c1-9(2)11(12)14-8-13-10-6-4-3-5-7-10;1-2;;/h3-7H,1,8H2,2H3;1-2H3;2*1H4.
What are the key properties of ethane;methane;phenoxymethyl 2-methylprop-2-enoate?
ethane;methane;phenoxymethyl 2-methylprop-2-enoate has a molecular weight of 254.37 g/mol, XLogP of 4.44, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;phenoxymethyl 2-methylprop-2-enoate is sourced from PubChem (CID 161278326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).