C27H24O6 — CID 20728904
[4-[4-[[(E)-3-phenylprop-2-enoyl]oxymethoxy]phenyl]phenoxy]methyl 2-methylprop-2-enoate (PubChem CID 20728904) has the molecular formula C27H24O6 and a molecular weight of 444.48 g/mol. Its IUPAC name is [4-[4-[[(E)-3-phenylprop-2-enoyl]oxymethoxy]phenyl]phenoxy]methyl 2-methylprop-2-enoate.
| Compound Name | [4-[4-[[(E)-3-phenylprop-2-enoyl]oxymethoxy]phenyl]phenoxy]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20728904 |
| Molecular Formula | C27H24O6 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | [4-[4-[[(E)-3-phenylprop-2-enoyl]oxymethoxy]phenyl]phenoxy]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCOc1ccc(-c2ccc(OCOC(=O)/C=C/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H24O6/c1-20(2)27(29)33-19-31-25-15-11-23(12-16-25)22-9-13-24(14-10-22)30-18-32-26(28)17-8-21-6-4-3-5-7-21/h3-17H,1,18-19H2,2H3/b17-8+ |
| InChIKey | YTMKNAACDJTXFI-CAOOACKPSA-N |
| XLogP | 5.40 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|