C23H24O4 — CID 175223098
2-(3-phenylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;styrene (PubChem CID 175223098) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-(3-phenylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;styrene.
| Compound Name | 2-(3-phenylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;styrene |
|---|---|
| PubChem CID | 175223098 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2-(3-phenylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;styrene |
| SMILES | C=C(C)C(=O)OCCOC(=O)C=Cc1ccccc1.C=Cc1ccccc1 |
| InChI | InChI=1S/C15H16O4.C8H8/c1-12(2)15(17)19-11-10-18-14(16)9-8-13-6-4-3-5-7-13;1-2-8-6-4-3-5-7-8/h3-9H,1,10-11H2,2H3;2-7H,1H2 |
| InChIKey | COLULAGTIJJBIV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|