C21H30O5 — CID 70370105
tert-butyl prop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate;styrene (PubChem CID 70370105) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is tert-butyl prop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate;styrene.
| Compound Name | tert-butyl prop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate;styrene |
|---|---|
| PubChem CID | 70370105 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | tert-butyl prop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate;styrene |
| SMILES | C=C(C)C(=O)OCCO.C=CC(=O)OC(C)(C)C.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C7H12O2.C6H10O3/c1-2-8-6-4-3-5-7-8;1-5-6(8)9-7(2,3)4;1-5(2)6(8)9-4-3-7/h2-7H,1H2;5H,1H2,2-4H3;7H,1,3-4H2,2H3 |
| InChIKey | MIPQVQDMMPEXCR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|