C20H30O5 — CID 123212080
ethylbenzene;2-hydroxyethyl prop-2-enoate;propyl 2-methylprop-2-enoate (PubChem CID 123212080) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is ethylbenzene;2-hydroxyethyl prop-2-enoate;propyl 2-methylprop-2-enoate.
| Compound Name | ethylbenzene;2-hydroxyethyl prop-2-enoate;propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123212080 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | ethylbenzene;2-hydroxyethyl prop-2-enoate;propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC.C=CC(=O)OCCO.CCc1ccccc1 |
| InChI | InChI=1S/C8H10.C7H12O2.C5H8O3/c1-2-8-6-4-3-5-7-8;1-4-5-9-7(8)6(2)3;1-2-5(7)8-4-3-6/h3-7H,2H2,1H3;2,4-5H2,1,3H3;2,6H,1,3-4H2 |
| InChIKey | XOPHSVJCEHLJLF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|