About 2-hydroxyethyl 2-methylprop-2-enoate;phenylmethoxymethylbenzene
2-hydroxyethyl 2-methylprop-2-enoate;phenylmethoxymethylbenzene (PubChem CID 70268341) has the molecular formula C20H24O4
and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;phenylmethoxymethylbenzene.
Molecular Properties
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;phenylmethoxymethylbenzene |
| PubChem CID | 70268341 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;phenylmethoxymethylbenzene |
| SMILES | C=C(C)C(=O)OCCO.c1ccc(COCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14O.C6H10O3/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-5(2)6(8)9-4-3-7/h1-10H,11-12H2;7H,1,3-4H2,2H3 |
| InChIKey | HUYHABHEJYWYOG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 2-methylprop-2-enoate;phenylmethoxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-methylprop-2-enoate;phenylmethoxymethylbenzene?
The IUPAC name of 2-hydroxyethyl 2-methylprop-2-enoate;phenylmethoxymethylbenzene (CID 70268341) is 2-hydroxyethyl 2-methylprop-2-enoate;phenylmethoxymethylbenzene.
What is the SMILES notation for 2-hydroxyethyl 2-methylprop-2-enoate;phenylmethoxymethylbenzene?
The canonical SMILES for 2-hydroxyethyl 2-methylprop-2-enoate;phenylmethoxymethylbenzene is C=C(C)C(=O)OCCO.c1ccc(COCc2ccccc2)cc1.
What is the InChIKey of 2-hydroxyethyl 2-methylprop-2-enoate;phenylmethoxymethylbenzene?
The InChIKey is HUYHABHEJYWYOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.C6H10O3/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-5(2)6(8)9-4-3-7/h1-10H,11-12H2;7H,1,3-4H2,2H3.
What are the key properties of 2-hydroxyethyl 2-methylprop-2-enoate;phenylmethoxymethylbenzene?
2-hydroxyethyl 2-methylprop-2-enoate;phenylmethoxymethylbenzene has a molecular weight of 328.41 g/mol, XLogP of 3.50, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-methylprop-2-enoate;phenylmethoxymethylbenzene is sourced from PubChem (CID 70268341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).