C25H25NO3 — CID 59392121
2-[[4-(N-phenylanilino)phenyl]methoxy]ethyl 2-methylprop-2-enoate (PubChem CID 59392121) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-[[4-(N-phenylanilino)phenyl]methoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[4-(N-phenylanilino)phenyl]methoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59392121 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-[[4-(N-phenylanilino)phenyl]methoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCc1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25NO3/c1-20(2)25(27)29-18-17-28-19-21-13-15-24(16-14-21)26(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-16H,1,17-19H2,2H3 |
| InChIKey | CPYGVQKFTIXVNR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|