C16H23NO2 — CID 150471657
2-[4-(diethylamino)phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 150471657) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-[4-(diethylamino)phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-(diethylamino)phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 150471657 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-[4-(diethylamino)phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C16H23NO2/c1-5-17(6-2)15-9-7-14(8-10-15)11-12-19-16(18)13(3)4/h7-10H,3,5-6,11-12H2,1-2,4H3 |
| InChIKey | HRXPEHLIOZGHOH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|