C31H29NO3 — CID 59392192
2-[[4-[4-(N-phenylanilino)phenyl]phenyl]methoxy]ethyl 2-methylprop-2-enoate (PubChem CID 59392192) has the molecular formula C31H29NO3 and a molecular weight of 463.58 g/mol. Its IUPAC name is 2-[[4-[4-(N-phenylanilino)phenyl]phenyl]methoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[4-[4-(N-phenylanilino)phenyl]phenyl]methoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59392192 |
| Molecular Formula | C31H29NO3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 2-[[4-[4-(N-phenylanilino)phenyl]phenyl]methoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCc1ccc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H29NO3/c1-24(2)31(33)35-22-21-34-23-25-13-15-26(16-14-25)27-17-19-30(20-18-27)32(28-9-5-3-6-10-28)29-11-7-4-8-12-29/h3-20H,1,21-23H2,2H3 |
| InChIKey | RBWCQRGEZBGWIK-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|