C34H31NO4 — CID 59832811
[4-[4-(2-methylprop-2-enoyloxymethyl)-N-(4-phenylphenyl)anilino]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 59832811) has the molecular formula C34H31NO4 and a molecular weight of 517.63 g/mol. Its IUPAC name is [4-[4-(2-methylprop-2-enoyloxymethyl)-N-(4-phenylphenyl)anilino]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [4-[4-(2-methylprop-2-enoyloxymethyl)-N-(4-phenylphenyl)anilino]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59832811 |
| Molecular Formula | C34H31NO4 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | [4-[4-(2-methylprop-2-enoyloxymethyl)-N-(4-phenylphenyl)anilino]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1ccc(N(c2ccc(COC(=O)C(=C)C)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C34H31NO4/c1-24(2)33(36)38-22-26-10-16-30(17-11-26)35(31-18-12-27(13-19-31)23-39-34(37)25(3)4)32-20-14-29(15-21-32)28-8-6-5-7-9-28/h5-21H,1,3,22-23H2,2,4H3 |
| InChIKey | FHUVLVJMQNMNLT-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|