C21H22O5 — CID 161249019
benzyl 2-methyl(113C)prop-2-enoate;benzyl 2-oxo(113C)propanoate (PubChem CID 161249019) has the molecular formula C21H22O5 and a molecular weight of 356.39 g/mol. Its IUPAC name is benzyl 2-methyl(113C)prop-2-enoate;benzyl 2-oxo(113C)propanoate.
| Compound Name | benzyl 2-methyl(113C)prop-2-enoate;benzyl 2-oxo(113C)propanoate |
|---|---|
| PubChem CID | 161249019 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | benzyl 2-methyl(113C)prop-2-enoate;benzyl 2-oxo(113C)propanoate |
| SMILES | C=C(C)[13C](=O)OCc1ccccc1.CC(=O)[13C](=O)OCc1ccccc1 |
| InChI | InChI=1S/C11H12O2.C10H10O3/c1-9(2)11(12)13-8-10-6-4-3-5-7-10;1-8(11)10(12)13-7-9-5-3-2-4-6-9/h3-7H,1,8H2,2H3;2-6H,7H2,1H3/i11+1;10+1 |
| InChIKey | VBADWLALYYGJQC-PQOHRRRMSA-N |
| XLogP | 3.62 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|