C23H32O6 — CID 20574609
benzyl 2-methylprop-2-enoate;tert-butyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 20574609) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is benzyl 2-methylprop-2-enoate;tert-butyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid.
| Compound Name | benzyl 2-methylprop-2-enoate;tert-butyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 20574609 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | benzyl 2-methylprop-2-enoate;tert-butyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OC(C)(C)C.C=C(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C11H12O2.C8H14O2.C4H6O2/c1-9(2)11(12)13-8-10-6-4-3-5-7-10;1-6(2)7(9)10-8(3,4)5;1-3(2)4(5)6/h3-7H,1,8H2,2H3;1H2,2-5H3;1H2,2H3,(H,5,6) |
| InChIKey | ITAJAJNQARUNBA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|