C20H22O2 — CID 175308811
(2-methyl-1,3-diphenylpropan-2-yl) 2-methylprop-2-enoate (PubChem CID 175308811) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is (2-methyl-1,3-diphenylpropan-2-yl) 2-methylprop-2-enoate.
| Compound Name | (2-methyl-1,3-diphenylpropan-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175308811 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (2-methyl-1,3-diphenylpropan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H22O2/c1-16(2)19(21)22-20(3,14-17-10-6-4-7-11-17)15-18-12-8-5-9-13-18/h4-13H,1,14-15H2,2-3H3 |
| InChIKey | ANAQIDCYKZJPPM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|