C27H26O4 — CID 157298221
2-methylprop-2-enoic acid;trityl 2-methylprop-2-enoate (PubChem CID 157298221) has the molecular formula C27H26O4 and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;trityl 2-methylprop-2-enoate.
| Compound Name | 2-methylprop-2-enoic acid;trityl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 157298221 |
| Molecular Formula | C27H26O4 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-methylprop-2-enoic acid;trityl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20O2.C4H6O2/c1-18(2)22(24)25-23(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;1-3(2)4(5)6/h3-17H,1H2,2H3;1H2,2H3,(H,5,6) |
| InChIKey | BBOYOKUOWVIQKU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|