About tris(4-methylphenyl) phosphate;trityl 2-methylprop-2-enoate
tris(4-methylphenyl) phosphate;trityl 2-methylprop-2-enoate (PubChem CID 174432388) has the molecular formula C44H41O6P
and a molecular weight of 696.78 g/mol. Its IUPAC name is tris(4-methylphenyl) phosphate;trityl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | tris(4-methylphenyl) phosphate;trityl 2-methylprop-2-enoate |
| PubChem CID | 174432388 |
| Molecular Formula | C44H41O6P |
| Molecular Weight | 696.78 g/mol |
| Exact Mass | 696.26 |
| IUPAC Name | tris(4-methylphenyl) phosphate;trityl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1.Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H20O2.C21H21O4P/c1-18(2)22(24)25-23(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;1-16-4-10-19(11-5-16)23-26(22,24-20-12-6-17(2)7-13-20)25-21-14-8-18(3)9-15-21/h3-17H,1H2,2H3;4-15H,1-3H3 |
| InChIKey | XUETYJHXNTVUKB-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 696.78 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze tris(4-methylphenyl) phosphate;trityl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(4-methylphenyl) phosphate;trityl 2-methylprop-2-enoate?
The IUPAC name of tris(4-methylphenyl) phosphate;trityl 2-methylprop-2-enoate (CID 174432388) is tris(4-methylphenyl) phosphate;trityl 2-methylprop-2-enoate.
What is the SMILES notation for tris(4-methylphenyl) phosphate;trityl 2-methylprop-2-enoate?
The canonical SMILES for tris(4-methylphenyl) phosphate;trityl 2-methylprop-2-enoate is C=C(C)C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1.Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1.
What is the InChIKey of tris(4-methylphenyl) phosphate;trityl 2-methylprop-2-enoate?
The InChIKey is XUETYJHXNTVUKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20O2.C21H21O4P/c1-18(2)22(24)25-23(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;1-16-4-10-19(11-5-16)23-26(22,24-20-12-6-17(2)7-13-20)25-21-14-8-18(3)9-15-21/h3-17H,1H2,2H3;4-15H,1-3H3.
What are the key properties of tris(4-methylphenyl) phosphate;trityl 2-methylprop-2-enoate?
tris(4-methylphenyl) phosphate;trityl 2-methylprop-2-enoate has a molecular weight of 696.78 g/mol, XLogP of 11.35, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris(4-methylphenyl) phosphate;trityl 2-methylprop-2-enoate is sourced from PubChem (CID 174432388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).