C29H28O9 — CID 159239644
2-hydroxypropane-1,2,3-tricarboxylic acid;trityl 2-methylprop-2-enoate (PubChem CID 159239644) has the molecular formula C29H28O9 and a molecular weight of 520.53 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;trityl 2-methylprop-2-enoate.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;trityl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159239644 |
| Molecular Formula | C29H28O9 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;trityl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H20O2.C6H8O7/c1-18(2)22(24)25-23(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-17H,1H2,2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | KTXMQJDIJIJWND-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|