C14H20O11 — CID 87330059
2-hydroxypropane-1,2,3-tricarboxylic acid;bis(2-methylprop-2-enoic acid) (PubChem CID 87330059) has the molecular formula C14H20O11 and a molecular weight of 364.30 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;bis(2-methylprop-2-enoic acid).
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 87330059 |
| Molecular Formula | C14H20O11 |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O7.2C4H6O2/c7-3(8)1-6(13,5(11)12)2-4(9)10;2*1-3(2)4(5)6/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);2*1H2,2H3,(H,5,6) |
| InChIKey | PWZBRCCVAXDLKH-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 206.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|