C7H11BrO7 — CID 158369615
bromomethane;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 158369615) has the molecular formula C7H11BrO7 and a molecular weight of 287.06 g/mol. Its IUPAC name is bromomethane;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | bromomethane;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 158369615 |
| Molecular Formula | C7H11BrO7 |
| Molecular Weight | 287.06 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | bromomethane;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CBr.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O7.CH3Br/c7-3(8)1-6(13,5(11)12)2-4(9)10;1-2/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H3 |
| InChIKey | GULIXLYSPKCBAQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.06 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|