About 2-hydroxypropane-1,2,3-tricarboxylic acid;rhodium(2+)
2-hydroxypropane-1,2,3-tricarboxylic acid;rhodium(2+) (PubChem CID 10469750) has the molecular formula C6H8O7Rh+2
and a molecular weight of 295.03 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;rhodium(2+).
Molecular Properties
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;rhodium(2+) |
| PubChem CID | 10469750 |
| Molecular Formula | C6H8O7Rh+2 |
| Molecular Weight | 295.03 g/mol |
| Exact Mass | 294.93 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;rhodium(2+) |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.[Rh+2] |
| InChI | InChI=1S/C6H8O7.Rh/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;+2 |
| InChIKey | ASSODYWICBOXIN-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.03 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxypropane-1,2,3-tricarboxylic acid;rhodium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropane-1,2,3-tricarboxylic acid;rhodium(2+)?
The IUPAC name of 2-hydroxypropane-1,2,3-tricarboxylic acid;rhodium(2+) (CID 10469750) is 2-hydroxypropane-1,2,3-tricarboxylic acid;rhodium(2+).
What is the SMILES notation for 2-hydroxypropane-1,2,3-tricarboxylic acid;rhodium(2+)?
The canonical SMILES for 2-hydroxypropane-1,2,3-tricarboxylic acid;rhodium(2+) is O=C(O)CC(O)(CC(=O)O)C(=O)O.[Rh+2].
What is the InChIKey of 2-hydroxypropane-1,2,3-tricarboxylic acid;rhodium(2+)?
The InChIKey is ASSODYWICBOXIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O7.Rh/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;+2.
What are the key properties of 2-hydroxypropane-1,2,3-tricarboxylic acid;rhodium(2+)?
2-hydroxypropane-1,2,3-tricarboxylic acid;rhodium(2+) has a molecular weight of 295.03 g/mol, XLogP of -1.25, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropane-1,2,3-tricarboxylic acid;rhodium(2+) is sourced from PubChem (CID 10469750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).