carbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid

C8H12O13 — CID 87148662

IUPACcarbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid
SMILESO=C(O)CC(O)(CC(=O)O)C(=O)O.O=C(O)O.O=C(O)O
InChIInChI=1S/C6H8O7.2CH2O3/c7-3(8)1-6(13,5(11)12)2-4(9)10;2*2-1(3)4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);2*(H2,2,3,4)
InChIKeyUQNNBRAOPSYZCM-UHFFFAOYSA-N
MW316.17 g/mol
LogP-0.80
Rot. Bonds5

About carbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid

carbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 87148662) has the molecular formula C8H12O13 and a molecular weight of 316.17 g/mol. Its IUPAC name is carbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid.

Molecular Properties

Compound Namecarbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid
PubChem CID87148662
Molecular FormulaC8H12O13
Molecular Weight316.17 g/mol
Exact Mass316.03
IUPAC Namecarbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid
SMILESO=C(O)CC(O)(CC(=O)O)C(=O)O.O=C(O)O.O=C(O)O
InChIInChI=1S/C6H8O7.2CH2O3/c7-3(8)1-6(13,5(11)12)2-4(9)10;2*2-1(3)4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);2*(H2,2,3,4)
InChIKeyUQNNBRAOPSYZCM-UHFFFAOYSA-N
XLogP-0.80
TPSA247.19 Ų
H-Bond Donors8
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms21
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500316.17
LogP ≤ 5-0.80
H-Bond Donors ≤ 58
H-Bond Acceptors ≤ 106

Analyze carbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid?
The IUPAC name of carbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid (CID 87148662) is carbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid.
What is the SMILES notation for carbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid?
The canonical SMILES for carbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid is O=C(O)CC(O)(CC(=O)O)C(=O)O.O=C(O)O.O=C(O)O.
What is the InChIKey of carbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid?
The InChIKey is UQNNBRAOPSYZCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O7.2CH2O3/c7-3(8)1-6(13,5(11)12)2-4(9)10;2*2-1(3)4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);2*(H2,2,3,4).
What are the key properties of carbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid?
carbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid has a molecular weight of 316.17 g/mol, XLogP of -0.80, 5 rotatable bonds, 8 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;2-hydroxypropane-1,2,3-tricarboxylic acid is sourced from PubChem (CID 87148662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).