C31H28O9 — CID 174813629
1-O-acetyl 2-O-(2-methylprop-2-enoyl) 3-O-trityl 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 174813629) has the molecular formula C31H28O9 and a molecular weight of 544.56 g/mol. Its IUPAC name is 1-O-acetyl 2-O-(2-methylprop-2-enoyl) 3-O-trityl 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | 1-O-acetyl 2-O-(2-methylprop-2-enoyl) 3-O-trityl 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 174813629 |
| Molecular Formula | C31H28O9 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | 1-O-acetyl 2-O-(2-methylprop-2-enoyl) 3-O-trityl 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | C=C(C)C(=O)OC(=O)C(O)(CC(=O)OC(C)=O)CC(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H28O9/c1-21(2)28(35)39-29(36)30(37,19-26(33)38-22(3)32)20-27(34)40-31(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,37H,1,19-20H2,2-3H3 |
| InChIKey | DRCNYMISYGMOIA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|