C36H34O5 — CID 174279576
[2-[2-(2-methylprop-2-enoyloxy)-2,2-diphenylethoxy]-1,1-diphenylethyl] 2-methylprop-2-enoate (PubChem CID 174279576) has the molecular formula C36H34O5 and a molecular weight of 546.66 g/mol. Its IUPAC name is [2-[2-(2-methylprop-2-enoyloxy)-2,2-diphenylethoxy]-1,1-diphenylethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[2-(2-methylprop-2-enoyloxy)-2,2-diphenylethoxy]-1,1-diphenylethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174279576 |
| Molecular Formula | C36H34O5 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | [2-[2-(2-methylprop-2-enoyloxy)-2,2-diphenylethoxy]-1,1-diphenylethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(COCC(OC(=O)C(=C)C)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H34O5/c1-27(2)33(37)40-35(29-17-9-5-10-18-29,30-19-11-6-12-20-30)25-39-26-36(41-34(38)28(3)4,31-21-13-7-14-22-31)32-23-15-8-16-24-32/h5-24H,1,3,25-26H2,2,4H3 |
| InChIKey | PIUWGNJBNNOFNS-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|